|
|
| | 4-(Cyclopropylaminocarbonyl)phenylboronic acid Basic information |
| | 4-(Cyclopropylaminocarbonyl)phenylboronic acid Chemical Properties |
| Melting point | 202-206°C | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 8.12±0.16(Predicted) | | form | solid | | color | white | | InChI | 1S/C10H12BNO3/c13-10(12-9-5-6-9)7-1-3-8(4-2-7)11(14)15/h1-4,9,14-15H,5-6H2,(H,12,13) | | InChIKey | WCRPDYXXIVYAAJ-UHFFFAOYSA-N | | SMILES | B(O)(O)c1ccc(cc1)C(=O)NC2CC2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-36 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Hazard Note | Irritant/Keep Cold | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 4-(Cyclopropylaminocarbonyl)phenylboronic acid Usage And Synthesis |
| | 4-(Cyclopropylaminocarbonyl)phenylboronic acid Preparation Products And Raw materials |
|