| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | (R)-3-(Dimethylamino) pyrrolidine dihydrochloride Basic information |
| Product Name: | (R)-3-(Dimethylamino) pyrrolidine dihydrochloride | | Synonyms: | DIMETHYL-PYRROLIDIN-3-YL-AMINE DIHYDROCHLORIDE, (R);DIMETHYL-PYRROLIDIN-3-YL-AMINE DIHYDROCHLORIDE;(R)-3-DIMETHYLAMINOPYRROLIDINE 2HCL;(R)-N,N-dimethylpyrrolidin-3-amine dihydrochloride;R- N,N-diMethyl-3-PyrrolidinaMine.2HCl;(R)-DiMethylpyrrolidin-3-yl-aMine dihydrochloride;(3R)-(+)-3-(DiMethylaMino)pyrrolidine 2HCl;(R)-N,N-Dimethyl-3-pyrrolidinamine Dihydrochloride | | CAS: | 864448-61-3 | | MF: | C6H16Cl2N2 | | MW: | 187.11064 | | EINECS: | | | Product Categories: | | | Mol File: | 864448-61-3.mol |  |
| | (R)-3-(Dimethylamino) pyrrolidine dihydrochloride Chemical Properties |
| Melting point | 194-197℃ | | storage temp. | Store at room temperature | | Appearance | White to off-white Solid | | Sensitive | Hygroscopic | | InChI | InChI=1/C6H14N2.2ClH/c1-8(2)6-3-4-7-5-6;;/h6-7H,3-5H2,1-2H3;2*1H/t6-;;/s3 | | InChIKey | LCPKWRSLMCUOOZ-VNWIKVLKNA-N | | SMILES | N1CC[C@@H](N(C)C)C1.[H]Cl.[H]Cl |&1:3,r| |
| | (R)-3-(Dimethylamino) pyrrolidine dihydrochloride Usage And Synthesis |
| Uses | (R)-N,N-Dimethylpyrrolidin-3-amine Dihydrochloride is used in the preparation of biphenylthiazoles against staphylococcus aureus. |
| | (R)-3-(Dimethylamino) pyrrolidine dihydrochloride Preparation Products And Raw materials |
|