| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
66853366 13670046396 |
| Email: |
sales@chem-strong.com |
| Products Intro: |
Product Name:Pazopanib Impurity 5
CAS:2369664-19-5
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Klong Industrial Co., Ltd
|
| Tel: |
519-68231162 13961227312 |
| Email: |
info@klongchem.com |
| Products Intro: |
Product Name:Pazopanib impurity 04
CAS:2369664-19-5
|
|
| | Benzenesulfonamide, 5-[[2-[(2,3-dimethyl-2H-indazol-6-yl)methylamino]-4-pyrimidinyl]amino]-2-methyl- Basic information |
| | Benzenesulfonamide, 5-[[2-[(2,3-dimethyl-2H-indazol-6-yl)methylamino]-4-pyrimidinyl]amino]-2-methyl- Chemical Properties |
| Boiling point | 736.0±70.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | pka | 10.17±0.60(Predicted) | | InChI | InChI=1S/C21H23N7O2S/c1-13-5-6-15(11-19(13)31(22,29)30)24-20-9-10-23-21(25-20)27(3)16-7-8-17-14(2)28(4)26-18(17)12-16/h5-12H,1-4H3,(H2,22,29,30)(H,23,24,25) | | InChIKey | AYPMSUKBOOFWCJ-UHFFFAOYSA-N | | SMILES | CC1N(N=C2C=C(N(C3=NC=CC(NC4C=CC(C)=C(S(=O)(=O)N)C=4)=N3)C)C=CC=12)C |
| | Benzenesulfonamide, 5-[[2-[(2,3-dimethyl-2H-indazol-6-yl)methylamino]-4-pyrimidinyl]amino]-2-methyl- Usage And Synthesis |
| Uses | 5-((2-((2,3-Dimethyl-2H-indazol-6-yl)(methyl)amino)pyrimidin-4-yl)amino)-2-methylbenzenesulfonamide is an impurity of Pazopanib (P210925), which is an oral angiogenesis inhibitor targeting VEGFR and PDGFR. |
| | Benzenesulfonamide, 5-[[2-[(2,3-dimethyl-2H-indazol-6-yl)methylamino]-4-pyrimidinyl]amino]-2-methyl- Preparation Products And Raw materials |
|