|
|
| | 3-Bromo-1-chlorodibenzofuran Basic information | | Application |
| | 3-Bromo-1-chlorodibenzofuran Chemical Properties |
| InChI | InChI=1S/C12H6BrClO/c13-7-5-9(14)12-8-3-1-2-4-10(8)15-11(12)6-7/h1-6H | | InChIKey | MYWRWRIVTKSBQG-UHFFFAOYSA-N | | SMILES | O1C2=CC=CC=C2C2=C(Cl)C=C(Br)C=C12 |
| | 3-Bromo-1-chlorodibenzofuran Usage And Synthesis |
| Application | 3-Bromo-1-chlorodibenzo[B,D]furan is a furan pharmaceutical intermediate mainly used in laboratory research and development processes and chemical research and development processes. | | Definition | 3-Bromo-1-chlorodibenzofuran is a chlorinated or brominated derivative of dibenzofuran. Dibenzofuran has been widely used for designing HTMs and host materials because of its high triplet energy and thermal stability, which make substituted dibenzofurans ideal materials for use in organic optoelectronic devices, including OLEDs, field-effect transistors, and photovoltaic cells.
|
| | 3-Bromo-1-chlorodibenzofuran Preparation Products And Raw materials |
|