| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (3R)-(-)-3-(Methyl-1H-indol-3-yl)-3-phenylpropionic acid Basic information |
| | (3R)-(-)-3-(Methyl-1H-indol-3-yl)-3-phenylpropionic acid Chemical Properties |
| Melting point | 135-139 °C | | Boiling point | 464.1±30.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | pka | 4.53±0.10(Predicted) | | Optical Rotation | [α]20/D -44°, c = 1% in chloroform | | InChI | 1S/C18H17NO2/c1-19-12-16(14-9-5-6-10-17(14)19)15(11-18(20)21)13-7-3-2-4-8-13/h2-10,12,15H,11H2,1H3,(H,20,21)/t15-/m1/s1 | | InChIKey | XVWRQAZBQVTVJA-OAHLLOKOSA-N | | SMILES | Cn1cc([C@H](CC(O)=O)c2ccccc2)c3ccccc13 |
| Hazard Codes | T | | Risk Statements | 25-36/37/38-42/43 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | (3R)-(-)-3-(Methyl-1H-indol-3-yl)-3-phenylpropionic acid Usage And Synthesis |
| | (3R)-(-)-3-(Methyl-1H-indol-3-yl)-3-phenylpropionic acid Preparation Products And Raw materials |
|