|
|
| | Ertugliflozin Impurity 5 Basic information |
| Product Name: | Ertugliflozin Impurity 5 | | Synonyms: | Ertugliflozin Impurity 5;Hydroxy Ertugliflozin;β-L-Idopyranose, 1,6-anhydro-1-C-[4-chloro-3-[(4-ethoxyphenyl)hydroxymethyl]phenyl]-5-C-(hydroxymethyl)-;(1S,2S,3S,4R,5S)-5-(4-chloro-3-((4-ethoxyphenyl)(hydroxy)methyl)phenyl)-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol;Ertugliflozin impurity 22;Ertugliflozin Impurity 49 | | CAS: | 1298086-28-8 | | MF: | C22H25ClO8 | | MW: | 452.88 | | EINECS: | | | Product Categories: | | | Mol File: | 1298086-28-8.mol |  |
| | Ertugliflozin Impurity 5 Chemical Properties |
| Boiling point | 673.6±55.0 °C(Predicted) | | density | 1.517±0.06 g/cm3(Predicted) | | pka | 12.94±0.70(Predicted) | | InChIKey | XLJINMDXOSTAIJ-BHPIROGQSA-N | | SMILES | O[C@@H]1[C@H]([C@@H]([C@@]2(CO[C@@]1(C1C=CC(=C(C=1)C(C1C=CC(=CC=1)OCC)O)Cl)O2)CO)O)O |
| | Ertugliflozin Impurity 5 Usage And Synthesis |
| | Ertugliflozin Impurity 5 Preparation Products And Raw materials |
|