| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2H-1-Benzopyran-3-carboxylic acid, 6,8-dichloro-2-(trifluoromethyl)- Basic information |
| | 2H-1-Benzopyran-3-carboxylic acid, 6,8-dichloro-2-(trifluoromethyl)- Chemical Properties |
| Boiling point | 388.4±42.0 °C(Predicted) | | density | 1.666±0.06 g/cm3(Predicted) | | pka | 2.81±0.40(Predicted) | | form | solid | | InChI | 1S/C11H5Cl2F3O3/c12-5-1-4-2-6(10(17)18)9(11(14,15)16)19-8(4)7(13)3-5/h1-3,9H,(H,17,18) | | InChIKey | ZFKBWSREWJOSSJ-UHFFFAOYSA-N | | SMILES | FC(F)(C1OC2=C(C=C1C(O)=O)C=C(Cl)C=C2Cl)F |
| WGK Germany | WGK 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | 2H-1-Benzopyran-3-carboxylic acid, 6,8-dichloro-2-(trifluoromethyl)- Usage And Synthesis |
| | 2H-1-Benzopyran-3-carboxylic acid, 6,8-dichloro-2-(trifluoromethyl)- Preparation Products And Raw materials |
|