| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1,2,3-Thiadiazole, 5-[(4-bromophenyl)thio]- Basic information |
| | 1,2,3-Thiadiazole, 5-[(4-bromophenyl)thio]- Chemical Properties |
| Boiling point | 387.9±48.0 °C(Predicted) | | density | 1.78±0.1 g/cm3(Predicted) | | form | solid | | pka | -5.07±0.50(Predicted) | | InChI | 1S/C8H5BrN2S2/c9-6-1-3-7(4-2-6)12-8-5-10-11-13-8/h1-5H | | InChIKey | UFTVWJQPYZVLHR-UHFFFAOYSA-N | | SMILES | BrC1=CC=C(C=C1)SC2=CN=NS2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | 1,2,3-Thiadiazole, 5-[(4-bromophenyl)thio]- Usage And Synthesis |
| | 1,2,3-Thiadiazole, 5-[(4-bromophenyl)thio]- Preparation Products And Raw materials |
|