| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | 2-Thiazolecarboxaldehyde, 4-(3-methoxyphenyl)- Basic information |
| | 2-Thiazolecarboxaldehyde, 4-(3-methoxyphenyl)- Chemical Properties |
| Boiling point | 391.3±34.0 °C(Predicted) | | density | 1.266±0.06 g/cm3(Predicted) | | pka | 0.05±0.50(Predicted) | | form | solid | | InChI | 1S/C11H9NO2S/c1-14-9-4-2-3-8(5-9)10-7-15-11(6-13)12-10/h2-7H,1H3 | | InChIKey | NYMXOZKXPMPIJD-UHFFFAOYSA-N | | SMILES | COC1=CC(C2=NC(C=O)=S=C2)=CC=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | 2-Thiazolecarboxaldehyde, 4-(3-methoxyphenyl)- Usage And Synthesis |
| | 2-Thiazolecarboxaldehyde, 4-(3-methoxyphenyl)- Preparation Products And Raw materials |
|