Benzeneacetic acid, 2-[(2,6-dichlorophenyl)nitrosoamino]- manufacturers
- N-Nitroso Diclofenac
-
-
2025-12-16
- CAS:66505-80-4
- Min. Order: 10mg
- Purity: 99%+ HPLC
- Supply Ability: 1000
|
| | Benzeneacetic acid, 2-[(2,6-dichlorophenyl)nitrosoamino]- Basic information |
| Product Name: | Benzeneacetic acid, 2-[(2,6-dichlorophenyl)nitrosoamino]- | | Synonyms: | Benzeneacetic acid, 2-[(2,6-dichlorophenyl)nitrosoamino]-;N-Nitrosodiclofenac;Diclofenac Impurity 38;N-Nitroso-Diclofec;L-(+)-Tartaric Acid Potassium Sodium Salt Tetrahydrate (Rochelle’s Salt);2-(2-((2,6-Dichlorophenyl)(nitroso)amino)phenyl)acetic acid;Diclofenac Impurity 2（N-nitroso-diclofenac）;Diclofenac Impurity 40 (N-Nitroso-Diclofenac) | | CAS: | 66505-80-4 | | MF: | C14H10Cl2N2O3 | | MW: | 325.15 | | EINECS: | | | Product Categories: | | | Mol File: | 66505-80-4.mol | ![Benzeneacetic acid, 2-[(2,6-dichlorophenyl)nitrosoamino]- Structure](CAS/20210305/GIF/66505-80-4.gif) |
| | Benzeneacetic acid, 2-[(2,6-dichlorophenyl)nitrosoamino]- Chemical Properties |
| Melting point | >115°C (dec.) | | Boiling point | 519.2±50.0 °C(Predicted) | | density | 1.43±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.03±0.10(Predicted) | | color | Off-White to Pale Yellow | | InChI | InChI=1S/C14H10Cl2N2O3/c15-10-5-3-6-11(16)14(10)18(17-21)12-7-2-1-4-9(12)8-13(19)20/h1-7H,8H2,(H,19,20) | | InChIKey | MRJVSFHDJGEONX-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC=CC=C1N(C1=C(Cl)C=CC=C1Cl)N=O |
| | Benzeneacetic acid, 2-[(2,6-dichlorophenyl)nitrosoamino]- Usage And Synthesis |
| Uses | N-Nitrosodiclofenac is an N-nitroso derivative of Diclofenac Acid (D436465), which is a nonsteroidal anti-inflammatory compound and decycloxygenase (COX) inhibitor. N-Nitrosodiclofenac can be used to be a novel composition to treat metabolic syndrome and other conditions. It can also be used to treat respiratory disorders. |
| | Benzeneacetic acid, 2-[(2,6-dichlorophenyl)nitrosoamino]- Preparation Products And Raw materials |
|