|
|
| | BENZYL BENZODITHIOATE Basic information |
| Product Name: | BENZYL BENZODITHIOATE | | Synonyms: | BENZYL DITHIOBENZOATE;BENZYL BENZODITHIOATE;Benzyl benzenecarbodithioate;Benzenecarbodithioic acid phenylmethyl ester;Dithiobenzoic acid benzyl ester;S-Benzyl dithiobenzoate;BDTB;Benzyl phenyl RAFT agent | | CAS: | 27249-90-7 | | MF: | C14H12S2 | | MW: | 244.38 | | EINECS: | | | Product Categories: | | | Mol File: | 27249-90-7.mol |  |
| | BENZYL BENZODITHIOATE Chemical Properties |
| Melting point | 55℃ | | Boiling point | 373℃ | | density | 1.200 | | refractive index | n20/D1.696 | | Fp | 179℃ | | storage temp. | 2-8°C | | form | clear liquid | | color | Orange to Brown to Dark red | | InChI | InChI=1S/C14H12S2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2 | | InChIKey | ZCKPFAYILJKXAT-UHFFFAOYSA-N | | SMILES | C1(C(=S)SCC2=CC=CC=C2)=CC=CC=C1 |
| Hazard Codes | Xn,N | | Risk Statements | 22-43-50/53 | | Safety Statements | 36/37-60-61 | | RIDADR | UN 3082 9 / PGIII | | WGK Germany | 3 | | HS Code | 2930.90.2900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Skin Sens. 1 |
| | BENZYL BENZODITHIOATE Usage And Synthesis |
| Uses | RAFT agent for controlled radical polymerization; Chain Transfer Agent (CTA) well-suited for methacrylates, methacrylamides, and styrenes. | | General Description | Need help choosing the correct RAFT Agent Please consult the RAFT Agent to Monomer compatibility table. |
| | BENZYL BENZODITHIOATE Preparation Products And Raw materials |
|