|
|
| | Methyl isopropyl ether Basic information |
| Product Name: | Methyl isopropyl ether | | Synonyms: | Methyl isopropyl ether;isopropyl methyl ether;Isopryl;Methyl 1-methylethyl ether;Propane, 2-Methoxy-;Propane, 2-Methoxy-(9CI);Methyl isopropyl ether:2-Methoxypropane;VinylIsobutylEther（Assumed） | | CAS: | 598-53-8 | | MF: | C4H10O | | MW: | 74.12 | | EINECS: | 209-937-1 | | Product Categories: | | | Mol File: | 598-53-8.mol |  |
| | Methyl isopropyl ether Chemical Properties |
| Melting point | -145.22°C | | Boiling point | 30.75°C | | density | 0.7140 | | refractive index | 1.3576 | | solubility | Chloroform, Methanol (Slightly) | | form | Oil | | color | Colourless | | Water Solubility | 61.03g/L(25 ºC) | | Stability: | Very Volatile | | InChI | InChI=1S/C4H10O/c1-4(2)5-3/h4H,1-3H3 | | InChIKey | RMGHERXMTMUMMV-UHFFFAOYSA-N | | SMILES | CC(OC)C |
| | Methyl isopropyl ether Usage And Synthesis |
| Uses | 2-Methoxy Propane is a synthetic intermediate used for the preparation of various biosynthetic molecules and pharmaceutical goods. | | Definition | ChEBI: An ether compound having methyl and isopropyl as the two alkyl groups. | | Purification Methods | Purify the ether by drying with CaSO4, passing through a column of alumina (to remove peroxides) and fractional distillation. [Beilstein 1 H 362, 1 II 381, 1 III 1458, 1 IV 1471.] |
| | Methyl isopropyl ether Preparation Products And Raw materials |
|