|
|
| | (1S,2S)-Boc-1,2-diaminocyclohexane Basic information |
| Product Name: | (1S,2S)-Boc-1,2-diaminocyclohexane | | Synonyms: | 1-N-BOC-1(S), 2(S)-CYCLOHEXYLDIAMINE;(1S,2S)-Boc-1,2-diaminocyclohexane;tert-butyl N-[(1S,2S)-2-aminocyclohexyl]carbamate;(1S,2S)-trans-N-Boc-1,2-Cyclohexanediamine;1-N-Boc-(1S,2S)-(+)-1,2-Diaminocyclohexane;N-tert-Butoxycarbonyl-S,S-1,2-diaminocyclohexane;tert-butyl ((1S,2S)-2-aminocyclohexyl)
carbamate;Carbamic acid, [(1S,2S)-2-aminocyclohexyl]-, 1,1-dimethylethyl ester (9CI) | | CAS: | 180683-64-1 | | MF: | C11H22N2O2 | | MW: | 214.3 | | EINECS: | | | Product Categories: | API intermediates | | Mol File: | 180683-64-1.mol |  |
| | (1S,2S)-Boc-1,2-diaminocyclohexane Chemical Properties |
| Melting point | 118-119 °C | | Boiling point | 322.1±31.0 °C(Predicted) | | density | 1.02±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | powder to crystal | | pka | 12.26±0.40(Predicted) | | color | White to Almost white | | BRN | 7745537 | | InChI | InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)13-9-7-5-4-6-8(9)12/h8-9H,4-7,12H2,1-3H3,(H,13,14)/t8-,9-/m0/s1 | | InChIKey | AKVIZYGPJIWKOS-IUCAKERBSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@H]1CCCC[C@@H]1N |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3259 8/PG 3 | | WGK Germany | 3 | | HS Code | 29242990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | (1S,2S)-Boc-1,2-diaminocyclohexane Usage And Synthesis |
| Chemical Properties | White crystal | | Uses | tert-Butyl N-[(1S,2S)-2-aminocyclohexyl]carbamate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| | (1S,2S)-Boc-1,2-diaminocyclohexane Preparation Products And Raw materials |
|