Ethyl 3,4,5-trimethoxybenzoylacetate manufacturers
|
| | Ethyl 3,4,5-trimethoxybenzoylacetate Basic information |
| Product Name: | Ethyl 3,4,5-trimethoxybenzoylacetate | | Synonyms: | ETHYL 3-(3,4,5-TRIMETHOXYPHENYL)-3-OXOPROPANOATE;ETHYL 3,4,5-TRIMETHOXYBENZOYLACETATE;ETHYL 3-OXO-3-(3,4,5-TRIMETHOXY-PHENYL)-PROPANOATE;ethyl 3-oxo-3-(3,4,5-trimethoxyphenyl)propionate;(3,4,5-Trimethoxybenzoyl)acetic acid ethyl ester;3-(3,4,5-Trimethoxyphenyl)-3-oxopropionic acid ethyl ester;3,4,5-Trimethoxy-β-oxobenzenepropanoic acid ethyl ester;β-Oxo-3,4,5-trimethoxybenzenepropanoic acid ethyl ester | | CAS: | 3044-56-2 | | MF: | C14H18O6 | | MW: | 282.29 | | EINECS: | 221-251-4 | | Product Categories: | Benzoic acid;C12 to C63;Carbonyl Compounds;Esters | | Mol File: | 3044-56-2.mol |  |
| | Ethyl 3,4,5-trimethoxybenzoylacetate Chemical Properties |
| Melting point | 88-91 °C (lit.) | | Boiling point | 384.9°C (rough estimate) | | density | 1.2640 (rough estimate) | | refractive index | 1.4795 (estimate) | | form | Crystalline Powder | | pka | 11.20±0.50(Predicted) | | color | White | | InChI | 1S/C14H18O6/c1-5-20-13(16)8-10(15)9-6-11(17-2)14(19-4)12(7-9)18-3/h6-7H,5,8H2,1-4H3 | | InChIKey | VEYNISLTHXQSGU-UHFFFAOYSA-N | | SMILES | CCOC(=O)CC(=O)c1cc(OC)c(OC)c(OC)c1 | | CAS DataBase Reference | 3044-56-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29183000 | | Storage Class | 11 - Combustible Solids |
| | Ethyl 3,4,5-trimethoxybenzoylacetate Usage And Synthesis |
| Chemical Properties | white crystalline powder |
| | Ethyl 3,4,5-trimethoxybenzoylacetate Preparation Products And Raw materials |
|