- Oleanonic acid
-
- $50.00 / 50mg
-
2026-05-14
- CAS:17990-42-0
- Min. Order:
- Purity: 99.82%
- Supply Ability: 10g
- Oleanonic acid
-
- $0.00 / 5mg
-
2023-02-24
- CAS:17990-42-0
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | 3-Oxo-olean-12-en-28-oic acid Basic information |
| | 3-Oxo-olean-12-en-28-oic acid Chemical Properties |
| Melting point | 190 °C | | Boiling point | 551.7±50.0 °C(Predicted) | | density | 1.09±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | pka | 4.65±0.70(Predicted) | | form | Solid | | color | White | | InChIKey | FMIMFCRXYXVFTA-FUAOEXFOSA-N | | SMILES | C1(=O)[C@@]([C@]2([C@](C)(CC1)[C@]1([H])[C@@]([C@]3(C(=CC1)[C@]1([C@@](CC[C@](C1)(C)C)(C(O)=O)CC3)[H])C)(C)CC2)[H])(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3-Oxo-olean-12-en-28-oic acid Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from Rehmannia root. | | Uses | Oleanonic Acid, is a derivative of Oleanolic Acid (O521000), which has been evaluated in vitro for their growth inhibition against human hepatocellular carcinoma cell line (HepG2) and colon cancer cell line, and thus used as antitumor agents. |
| | 3-Oxo-olean-12-en-28-oic acid Preparation Products And Raw materials |
|