|
|
| | 1-Dibenzofuranamine, N-phenyl- Basic information |
| Product Name: | 1-Dibenzofuranamine, N-phenyl- | | Synonyms: | 1-Dibenzofuranamine, N-phenyl-;N-phenyl-Dibenzofuranamine;N-phenyl-1-aminodibenzofuran;N-phenyl-1-Dibenzofuranamine;Dibenzofuran-1-yl-phenyl-amine;N-Phenylan-1-aminodibenzofuran | | CAS: | 1325195-27-4 | | MF: | C18H13NO | | MW: | 259.3 | | EINECS: | | | Product Categories: | | | Mol File: | 1325195-27-4.mol |  |
| | 1-Dibenzofuranamine, N-phenyl- Chemical Properties |
| Boiling point | 451.6±18.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | pka | 3.73±0.30(Predicted) | | InChI | InChI=1S/C18H13NO/c1-2-7-13(8-3-1)19-15-10-6-12-17-18(15)14-9-4-5-11-16(14)20-17/h1-12,19H | | InChIKey | ACBWMRLJWKZADU-UHFFFAOYSA-N | | SMILES | O1C2=CC=CC=C2C2=C(NC3=CC=CC=C3)C=CC=C12 |
| | 1-Dibenzofuranamine, N-phenyl- Usage And Synthesis |
| | 1-Dibenzofuranamine, N-phenyl- Preparation Products And Raw materials |
|