1,3,5-triazine-2,4,6(1H,3H,5H)-trione trihydrazone manufacturers
|
| | 1,3,5-triazine-2,4,6(1H,3H,5H)-trione trihydrazone Basic information |
| Product Name: | 1,3,5-triazine-2,4,6(1H,3H,5H)-trione trihydrazone | | Synonyms: | 1,3,5-triazine-2,4,6(1H,3H,5H)-trione trihydrazone;1,3,5-Triazine-2,4,6(1H,3H,5H)-trione trishydrazone;2,4,6-Trihydrazino-1,3,5-triazine;1,3,5-Triazine, 2,4,6-trihydrazinyl-;Trihydrazine Triazine;2,4,6-trihydrazinyl-1,3,5-Triazine;cyanuric trihydrazide;Trihydrazine Triazine (THT) | | CAS: | 10105-42-7 | | MF: | C3H9N9 | | MW: | 171.16 | | EINECS: | 233-288-3 | | Product Categories: | | | Mol File: | 10105-42-7.mol |  |
| | 1,3,5-triazine-2,4,6(1H,3H,5H)-trione trihydrazone Chemical Properties |
| Melting point | >300 °C (decomp) | | Boiling point | 382.7±25.0 °C(Predicted) | | density | 2.41±0.1 g/cm3(Predicted) | | pka | 1.74±0.20(Predicted) | | InChI | InChI=1S/C3H9N9/c4-10-1-7-2(11-5)9-3(8-1)12-6/h4-6H2,(H3,7,8,9,10,11,12) | | InChIKey | CZGWDPMDAIPURF-UHFFFAOYSA-N | | SMILES | N1=C(NN)N=C(NN)N=C1NN | | EPA Substance Registry System | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, trihydrazone (10105-42-7) |
| | 1,3,5-triazine-2,4,6(1H,3H,5H)-trione trihydrazone Usage And Synthesis |
| Uses | 1,3,5-triazine-2,4,6(1H,3H,5H)-trione trihydrazone is a chemical blowing agent. It is one of the blowing agent components used in the production of skin-core foamed polyester fibres, coloured encapsulation films and polyether ether ketone resins, amongst other materials. It can also be substituted with p-toluenesulphonyl semicarbazide (CAS 10396-10-8) and p,p'-oxybis(benzenesulphonyl semicarbazide) (CAS 10195-67-2). |
| | 1,3,5-triazine-2,4,6(1H,3H,5H)-trione trihydrazone Preparation Products And Raw materials |
|