|
|
| | 2-bromo-N-[2-(2-chlorobenzoyl)-4-nitrophenyl]acetamide Basic information |
| | 2-bromo-N-[2-(2-chlorobenzoyl)-4-nitrophenyl]acetamide Chemical Properties |
| Melting point | 147-149°C | | Boiling point | 616.7±55.0 °C(Predicted) | | density | 1.673±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 10.59±0.70(Predicted) | | color | Pale Yellow to Light Yellow | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C15H10BrClN2O4/c16-8-14(20)18-13-6-5-9(19(22)23)7-11(13)15(21)10-3-1-2-4-12(10)17/h1-7H,8H2,(H,18,20) | | InChIKey | XSTMFEOLMKEEMU-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc(NC(=O)CBr)c(c1)C(=O)c2ccccc2Cl |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| | 2-bromo-N-[2-(2-chlorobenzoyl)-4-nitrophenyl]acetamide Usage And Synthesis |
| Chemical Properties | Beige Solid | | Uses | An impurity from the synthesis of clonazepam (C587080) |
| | 2-bromo-N-[2-(2-chlorobenzoyl)-4-nitrophenyl]acetamide Preparation Products And Raw materials |
|