|
|
| | 2-chloro-6-methoxybenzoic acid Basic information |
| Product Name: | 2-chloro-6-methoxybenzoic acid | | Synonyms: | 6-Chloro-o-anisic acid (COOH=1);2-Methoxy-6-chlorobenzoic acid;Benzoic acid, 2-chloro-6-methoxy-;2-CHLORO-6-METHOXYBENZOIC ACID | | CAS: | 3260-89-7 | | MF: | C8H7ClO3 | | MW: | 186.59 | | EINECS: | 221-863-1 | | Product Categories: | | | Mol File: | 3260-89-7.mol |  |
| | 2-chloro-6-methoxybenzoic acid Chemical Properties |
| Melting point | 141 °C | | Boiling point | 304.6±22.0 °C(Predicted) | | density | 1.352±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 2.87±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C8H7ClO3/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4H,1H3,(H,10,11) | | InChIKey | JUOHBAJZQDTICO-UHFFFAOYSA-N | | SMILES | ClC1=C(C(O)=O)C(OC)=CC=C1 |
| WGK Germany | WGK 3 | | HS Code | 2918999090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-chloro-6-methoxybenzoic acid Usage And Synthesis |
| Uses | 2-chloro-6-methoxybenzoic acid can be used as a versatile intermediate in the synthesis of various organic compounds. |
| | 2-chloro-6-methoxybenzoic acid Preparation Products And Raw materials |
|