4-aminopentan-1-ol manufacturers
- 4-aminopentan-1-ol
-
-
2025-12-24
- CAS:927-55-9
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 1000KG
|
| | 4-aminopentan-1-ol Basic information |
| | 4-aminopentan-1-ol Chemical Properties |
| Melting point | 32°C | | Boiling point | 117-119°C/25 mm | | density | 0.915±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 15.12±0.10(Predicted) | | color | Off-White to Pale Yellow | | InChI | InChI=1S/C5H13NO/c1-5(6)3-2-4-7/h5,7H,2-4,6H2,1H3 | | InChIKey | JAXJUENAJXWFBX-UHFFFAOYSA-N | | SMILES | C(O)CCC(N)C |
| | 4-aminopentan-1-ol Usage And Synthesis |
| Chemical Properties | Pale Yellow Low Melting Solid |
| | 4-aminopentan-1-ol Preparation Products And Raw materials |
|