- DihydrojasMonic Acid
-
- $1.00 / 1Kg
-
2024-07-20
- CAS:3572-64-3
- Min. Order: 1Kg
- Purity: 98%
- Supply Ability: 20T
|
| | 3-oxo-2-pentylcyclopentaneacetic acid Basic information |
| Product Name: | 3-oxo-2-pentylcyclopentaneacetic acid | | Synonyms: | 2-Pentyl-3-oxocyclopentane-1-acetic acid;(±)-9,10-DIHYDROJASMONIC ACID (DJA);Cyclopentaneacetic acid, 3-oxo-2-pentyl-;Einecs 222-687-8;2-Amyl-3-(carboxymethyl)cyclopentanone
2-Amyl-3-oxocyclopentaneacetic Acid
3-(Carboxymethyl)-2-pentylcyclopentanone
3-Oxo-2-pentylcyclopentaneacetic Acid;DihydrojasmonicAcid>;Jasmonic Acid Impurity 5 ((±)-9,10-Dihydrojasmonic Acid);(+/-)-Dihydrojasmonic acid | | CAS: | 3572-64-3 | | MF: | C12H20O3 | | MW: | 212.29 | | EINECS: | 222-687-8 | | Product Categories: | | | Mol File: | 3572-64-3.mol |  |
| | 3-oxo-2-pentylcyclopentaneacetic acid Chemical Properties |
| Boiling point | 361.9±15.0 °C(Predicted) | | density | 1.038±0.06 g/cm3(Predicted) | | refractive index | 1.4700-1.4750 | | storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 4.52±0.10(Predicted) | | form | Oil | | color | Colourless | | InChI | 1S/C12H20O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h9-10H,2-8H2,1H3,(H,14,15) | | InChIKey | PQEYTAGBXNEUQL-UHFFFAOYSA-N | | SMILES | O=C1C(CCCCC)C(CC1)CC(O)=O | | EPA Substance Registry System | Cyclopentaneacetic acid, 3-oxo-2-pentyl- (3572-64-3) |
| WGK Germany | WGK 3 | | TSCA | TSCA listed | | HS Code | 2915.90.5050 | | Storage Class | 11 - Combustible Solids |
| | 3-oxo-2-pentylcyclopentaneacetic acid Usage And Synthesis |
| Uses | (±)-9,10-Dihydrojasmonic Acid can be used as analyte in biological and analytical study for UHPLC-MS/MS based target profiling of stress-induced phytohormones including jasmonic acid and its precursors and amino acid conjugates. | | Definition | ChEBI: 9,10-Dihydrojasmonic acid is a member of Jasmonate derivatives. It is functionally related to a jasmonic acid. |
| | 3-oxo-2-pentylcyclopentaneacetic acid Preparation Products And Raw materials |
|