- isononyl alcohol
-
-
2026-06-30
- CAS:27458-94-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
- isononyl alcohol
-
- $6.00
-
2025-07-29
- CAS:27458-94-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 2000KG/Month
|
| | isononyl alcohol Basic information |
| Product Name: | isononyl alcohol | | Synonyms: | Isononyl alcohol;Einecs 248-471-3;Isononanol (9CI);isononanols;7-Methyloctan-1-ol;Isononylalkohol;nonanol、isononyl alcohol | | CAS: | 27458-94-2 | | MF: | C9H20O | | MW: | 144.25 | | EINECS: | 248-471-3 | | Product Categories: | PAINT | | Mol File: | 27458-94-2.mol |  |
| | isononyl alcohol Chemical Properties |
| Melting point | 64-65 °C | | Boiling point | 100 °C(Press: 13 Torr) | | density | 8347[at 20℃] | | vapor pressure | 2.6Pa at 19.85℃ | | Water Solubility | 245mg/L at 20℃ | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C9H20O/c1-9(2)7-5-3-4-6-8-10/h9-10H,3-8H2,1-2H3 | | InChIKey | QDTDKYHPHANITQ-UHFFFAOYSA-N | | SMILES | C(O)CCCCCC(C)C | | LogP | 3.230 (est) | | EPA Substance Registry System | Isononanol (27458-94-2) |
| RIDADR | 3082 | | HazardClass | 9 | | PackingGroup | III |
| | isononyl alcohol Usage And Synthesis |
| Uses | Basis of plasticizers such as diisononyl adipate. | | Definition | A Higher alcohol developed in early 1968. Combustible. | | Production Methods | Isononyl alcohol is made in the oxo process by reacting
olefins with carbon monoxide and hydrogen in the presence
of a catalyst, followed by hydrogenation. The commercial
product typically consists of dimethyl-1-heptanols and
methyl-1-octanols; the composition and CAS registry number
depend on the olefin feedstock. | | Flammability and Explosibility | Non flammable |
| | isononyl alcohol Preparation Products And Raw materials |
|