| Company Name: |
Accela ChemBio Inc. |
| Tel: |
+1-858-6993322 +86-18019713315 |
| Email: |
info@accelachem.com |
|
| | (S)-3,7-dimethyl-1,6-octadien-3-ol Basic information |
| Product Name: | (S)-3,7-dimethyl-1,6-octadien-3-ol | | Synonyms: | (S)-3,7-dimethyl-1,6-octadien-3-ol;1,6-Octadien-3-ol, 3,7-dimethyl-, (3S)-;LINALOOLSYNTHETIC;(s)-3,7-dimethyl-1,6;6-Octadien-3-ol, 3,7-dimethyl-, (S)-1;7-dimethyl-6-octadien-3-o (s)-3;Dextro-linalool(natural);dextro-linalool | | CAS: | 126-90-9 | | MF: | C10H18O | | MW: | 154.25 | | EINECS: | 204-810-7 | | Product Categories: | | | Mol File: | 126-90-9.mol |  |
| | (S)-3,7-dimethyl-1,6-octadien-3-ol Chemical Properties |
| Melting point | 38-39 °C | | Boiling point | 87-88 °C | | density | 0.8700 g/cm3 | | FEMA | 2635 | LINALOOL | | storage temp. | 2-8°C, stored under nitrogen | | pka | 14.51±0.29(Predicted) | | Odor | at 100.00 %. sweet floral petitgrain lavender | | Appearance | Colorless to light yellow Liquid | | Odor Type | floral | | JECFA Number | 356 | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C10H18O/c1-5-10(4,11)8-6-7-9(2)3/h5,7,11H,1,6,8H2,2-4H3/t10-/m1/s1 | | InChIKey | CDOSHBSSFJOMGT-SNVBAGLBSA-N | | SMILES | C=C[C@@](C)(O)CC/C=C(\C)/C | | LogP | 2.795 (est) | | EPA Substance Registry System | 1,6-Octadien-3-ol, 3,7-dimethyl-, (3S)- (126-90-9) |
| | (S)-3,7-dimethyl-1,6-octadien-3-ol Usage And Synthesis |
| Definition | ChEBI: The (S)-enantiomer of linalool. |
| | (S)-3,7-dimethyl-1,6-octadien-3-ol Preparation Products And Raw materials |
|