| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Ethylene-β-ionol CAS:59057-30-6 Package:200Mg,2g
|
|
| | (E)-(±)-3-methyl-1-(2,6,6-trimethylcyclohex-1-en-1-yl)penta-1,4-dien-3-ol Basic information |
| Product Name: | (E)-(±)-3-methyl-1-(2,6,6-trimethylcyclohex-1-en-1-yl)penta-1,4-dien-3-ol | | Synonyms: | (E)-(±)-3-methyl-1-(2,6,6-trimethylcyclohex-1-en-1-yl)penta-1,4-dien-3-ol;(E)-(1)-3-Methyl-1-(2,6,6-trimethylcyclohex-1-en-1-yl)penta-1,4-dien-3-ol;Einecs 261-585-8;(E)-3-methyl-1-(2,6,6-trimethylcyclohex-1-enyl)penta-1,4-dien-3-ol;vinyl-β-ionol;1,4-Pentadien-3-ol, 3-methyl-1-(2,6,6-trimethyl-1-cyclohexen-1-yl)-, (1E)-;Ethylene-β-ionol;3-methyl-1-(2,6,6-trimethylcyclohex-1-en-1-yl)penta-1,4-dien... | | CAS: | 59057-30-6 | | MF: | C15H24O | | MW: | 220.35 | | EINECS: | 261-585-8 | | Product Categories: | Aliphatics;Intermediates | | Mol File: | 59057-30-6.mol |  |
| | (E)-(±)-3-methyl-1-(2,6,6-trimethylcyclohex-1-en-1-yl)penta-1,4-dien-3-ol Chemical Properties |
| Boiling point | 315.3±11.0 °C(Predicted) | | density | 0.948±0.06 g/cm3(Predicted) | | solubility | Dichloromethane, Ether, Ethyl Acetate, Methanol | | form | Oil | | pka | 13?+-.0.29(Predicted) | | color | Light Yellow | | InChI | InChI=1S/C15H24O/c1-6-15(5,16)11-9-13-12(2)8-7-10-14(13,3)4/h6,9,11,16H,1,7-8,10H2,2-5H3/b11-9+ | | InChIKey | PZGYHDPZANRCSM-PKNBQFBNSA-N | | SMILES | C(/C1C(C)(C)CCCC=1C)=C\C(C)(O)C=C |
| | (E)-(±)-3-methyl-1-(2,6,6-trimethylcyclohex-1-en-1-yl)penta-1,4-dien-3-ol Usage And Synthesis |
| Chemical Properties | Light Yellow Oil | | Uses | α-Ionol derivative. |
| | (E)-(±)-3-methyl-1-(2,6,6-trimethylcyclohex-1-en-1-yl)penta-1,4-dien-3-ol Preparation Products And Raw materials |
|