|
|
| | 2-hydroxyethyl benzoate Basic information |
| Product Name: | 2-hydroxyethyl benzoate | | Synonyms: | Ethylene Glycol Monobenzoate;1,2-Ethanediol 1-benzoate;2-(Benzoyloxy)ethanol;Ethane-1,2-diol 1-benzoate;Reaxys ID: 1866806;2-Hydroxyethyl Benzoate
(Ethylene Glycol Monobenzoate);2-hydroxyethylbenzenemacetic acidester | | CAS: | 94-33-7 | | MF: | C9H10O3 | | MW: | 166.17 | | EINECS: | 202-323-4 | | Product Categories: | | | Mol File: | 94-33-7.mol |  |
| | 2-hydroxyethyl benzoate Chemical Properties |
| Melting point | 45°C | | Boiling point | 254.38°C (rough estimate) | | density | 1.1101 | | refractive index | 1.5260 (estimate) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | pka | 14.04±0.10(Predicted) | | color | Colourless to Off-White Oil | | InChI | InChI=1S/C9H10O3/c10-6-7-12-9(11)8-4-2-1-3-5-8/h1-5,10H,6-7H2 | | InChIKey | LSWRBVSEWBWTDR-UHFFFAOYSA-N | | SMILES | C(OC(=O)C1=CC=CC=C1)CO | | EPA Substance Registry System | 1,2-Ethanediol, monobenzoate (94-33-7) |
| | 2-hydroxyethyl benzoate Usage And Synthesis |
| Uses | Ethylene Glycol Monobenzoate, is a reagent that can be used as an intermediate in a variety of chemical and biochemical reactions. It is used as an intermediate in the preparation of 1,2-Ethanediol Disodium Salt (E890125), which is the result of the nucleophilic attack on its carbonyl group. |
| | 2-hydroxyethyl benzoate Preparation Products And Raw materials |
|