| Company Name: |
DebyeTec.com Inc. |
| Tel: |
18086626237 18086626237 |
| Email: |
2693528373@qq.com |
1-phenylpropane-1,2-diol manufacturers
|
| | 1-phenylpropane-1,2-diol Basic information |
| Product Name: | 1-phenylpropane-1,2-diol | | Synonyms: | 1-phenylpropane-1,2-diol;1,2-Dihydroxy-1-phenylpropane;Phenylpropanediol;1-phenyl-1,2-propandiol;Felbamate Impurity 10;1,2-Propanediol, 1-phenyl- | | CAS: | 1855-09-0 | | MF: | C9H12O2 | | MW: | 152.19 | | EINECS: | 217-452-1 | | Product Categories: | | | Mol File: | 1855-09-0.mol |  |
| | 1-phenylpropane-1,2-diol Chemical Properties |
| Melting point | 56-57 °C | | Boiling point | 140-145 °C(Press: 30 Torr) | | density | 1.1003 g/cm3 | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Low-Melting Solid | | pka | 14.09±0.20(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C9H12O2/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9-11H,1H3 | | InChIKey | MZQZXSHFWDHNOW-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(O)C(O)C | | EPA Substance Registry System | 1,2-Propanediol, 1-phenyl- (1855-09-0) |
| TSCA | TSCA listed | | HS Code | 2906290000 |
| | 1-phenylpropane-1,2-diol Usage And Synthesis |
| Uses | 1-Phenyl-1,2-propanediol is a reagent in pharmaceutical chemistry, used in the synthesis of nor(pseudo)ephedrine related compounds. |
| | 1-phenylpropane-1,2-diol Preparation Products And Raw materials |
|