|
|
| | N-[2-(2,4,6-trichlorophenoxy)ethyl]propylamine Basic information |
| Product Name: | N-[2-(2,4,6-trichlorophenoxy)ethyl]propylamine | | Synonyms: | N-[2-(2,4,6-trichlorophenoxy)ethyl]propylamine;N-(2,4,6-TRICHLORO PHENOXY)ETHYL N-PROPYL AMINE;2-(2,4,6-Trichlorophenoxy)ethylpropylamine;N-[2-(2,4,6-Trichlorophenoxy)ethyl]-1-propanamine;N-(2-(2,4,6-Trichlorophenoxy)ethyl)propan-1-aMine;β-(2,4,6-Trichlorphenoxy)-ethyl-n-propylamin;Prochloraz Metabolite BTS 40348;1-Propanamine, N-[2-(2,4,6-trichlorophenoxy)ethyl]- | | CAS: | 67747-01-7 | | MF: | C11H14Cl3NO | | MW: | 282.59 | | EINECS: | 266-992-4 | | Product Categories: | | | Mol File: | 67747-01-7.mol | ![N-[2-(2,4,6-trichlorophenoxy)ethyl]propylamine Structure](CAS/GIF/67747-01-7.gif) |
| | N-[2-(2,4,6-trichlorophenoxy)ethyl]propylamine Chemical Properties |
| Boiling point | 361.1±42.0 °C(Predicted) | | density | 1.260±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightlyu), Methanol (Slightly) | | form | Oil | | pka | 9.19±0.19(Predicted) | | color | Colourless to Brown | | Major Application | agriculture
environmental | | InChI | 1S/C11H14Cl3NO/c1-2-3-15-4-5-16-11-9(13)6-8(12)7-10(11)14/h6-7,15H,2-5H2,1H3 | | InChIKey | CLFQSOIBYICELN-UHFFFAOYSA-N | | SMILES | ClC1=C(OCCNCCC)C(Cl)=CC(Cl)=C1 |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 4 |
| | N-[2-(2,4,6-trichlorophenoxy)ethyl]propylamine Usage And Synthesis |
| Chemical Properties | It is colorless oily liquid, pure b.p. 112～114℃/27pa, insoluble in water, soluble in alcohol, benzene, ether and other organic solvents. With hydrochloric acid into hydrochloride, m.p. 210 ~ 213 ℃, soluble in water. | | Uses | N-(2-(2,4,6-Trichlorophenoxy)ethyl)propan-1-amine is a metabolite of Prochloraz which is a widely used imidazole fungicide. |
| | N-[2-(2,4,6-trichlorophenoxy)ethyl]propylamine Preparation Products And Raw materials |
|