|
|
| | 2-ethylhexyl hydrogen -2-ethylhexylphosphonate Basic information |
| Product Name: | 2-ethylhexyl hydrogen -2-ethylhexylphosphonate | | Synonyms: | 2-ethylhexyl hydrogen -2-ethylhexylphosphonate;2-Ethylhexylphosphoric Acid Mono-2-Ethylhexyl Ester;Phosphonic acid, (2-ethylhexyl)-, mono(2-ethylhexyl) ester;(2-ethylhexyl)-phosphonic aci mono(2-ethylhexyl) ester;2-Ethyl hexylphosphic mono-2-ethylhexyl ester;2-Ethylhexylphosphonic acid mono-(2-ethylhexyl)-ester;PHOSPHONIC ACID (2-ETHYLHEXYL)-MONO(2-ETHLHEXYL)ESTER;mono(2-ethylhexyl) 2-ethylhexylphosphonate | | CAS: | 14802-03-0 | | MF: | C16H35O3P | | MW: | 306.42 | | EINECS: | 238-865-3 | | Product Categories: | Industrial/Fine Chemicals | | Mol File: | 14802-03-0.mol |  |
| | 2-ethylhexyl hydrogen -2-ethylhexylphosphonate Chemical Properties |
| Boiling point | 390.6±25.0 °C(Predicted) | | density | 0.953±0.06 g/cm3(Predicted) | | refractive index | 1.4480-1.4520 | | Fp | 173°C(lit.) | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | clear liquid | | pka | 2.95±0.10(Predicted) | | color | Colorless to Light yellow | | InChI | InChI=1S/C16H35O3P/c1-5-9-11-15(7-3)13-19-20(17,18)14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3,(H,17,18) | | InChIKey | ZDFBXXSHBTVQMB-UHFFFAOYSA-N | | SMILES | P(CC(CC)CCCC)(=O)(O)OCC(CC)CCCC | | EPA Substance Registry System | Phosphonic acid, (2-ethylhexyl)-, mono(2-ethylhexyl) ester (14802-03-0) |
| RIDADR | 3265 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29349990 |
| | 2-ethylhexyl hydrogen -2-ethylhexylphosphonate Usage And Synthesis |
| Chemical Properties | 2-ethylhexyl hydrogen -2-ethylhexylphosphonate is a yellow liquid. Soluble in kerosene, petroleum ether, alcohol, insoluble in water. | | Uses | 2-ethylhexyl hydrogen -2-ethylhexylphosphonate belongs to ester organic matter, an acidic phosphorus type extractant, which is used for the extraction and separation of rare earth elements and non-ferrous metals. |
| | 2-ethylhexyl hydrogen -2-ethylhexylphosphonate Preparation Products And Raw materials |
|