- Melitracen Impurity
-
-
2025-12-16
- CAS:5447-86-9
- Min. Order: 10mg
- Purity: 99%+ HPLC
- Supply Ability: 1000
|
| | 10,10-Dimethylanthrone Basic information |
| Product Name: | 10,10-Dimethylanthrone | | Synonyms: | 10,10-Dimethyl-9,10-dihydroanthracen-9-one;10,10-dimethylanthracen-9-one;10,10-Dimethylanthrone;10,10-DiMethyl-9(10H)-anthracenone;10,10-DiMethyl-9-anthrone;NSC 17539;9(10H)-Anthracenone,10,10-dimethyl-;226-666-4 | | CAS: | 5447-86-9 | | MF: | C16H14O | | MW: | 222.28 | | EINECS: | 226-666-4 | | Product Categories: | Aromatics;Miscellaneous Reagents | | Mol File: | 5447-86-9.mol |  |
| | 10,10-Dimethylanthrone Chemical Properties |
| Melting point | 101-103°C | | Boiling point | 346.6±22.0 °C(Predicted) | | density | 1.105±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | Off-White to Light Yellow | | InChI | InChI=1S/C16H14O/c1-16(2)13-9-5-3-7-11(13)15(17)12-8-4-6-10-14(12)16/h3-10H,1-2H3 | | InChIKey | GWFCYDIAPRIMLA-UHFFFAOYSA-N | | SMILES | C1=C2C(C(C)(C)C3=C(C2=O)C=CC=C3)=CC=C1 |
| | 10,10-Dimethylanthrone Usage And Synthesis |
| Chemical Properties | Light Yellow Solid | | Uses | Derivative of Anthrone |
| | 10,10-Dimethylanthrone Preparation Products And Raw materials |
|