|
|
| | 3,4-Difluoro-6-Nitrophenol Basic information |
| Product Name: | 3,4-Difluoro-6-Nitrophenol | | Synonyms: | 3,4-Difluoro-6-Nitrophenol;4,5-Difluoro-2-nitrophenol97%;4,5-Difluoro-2-hydroxynitrobenzene;Phenol, 4,5-difluoro-2-nitro-;3,4-Difluoro-6-Nitrophenol ISO 9001:2015 REACH | | CAS: | 55346-97-9 | | MF: | C6H3F2NO3 | | MW: | 175.09 | | EINECS: | | | Product Categories: | | | Mol File: | 55346-97-9.mol |  |
| | 3,4-Difluoro-6-Nitrophenol Chemical Properties |
| Boiling point | 249℃ | | density | 1.619 | | Fp | 104℃ | | storage temp. | Sealed in dry,Room Temperature | | pka | 5.84±0.27(Predicted) | | form | crystalline solid | | color | Yellow | | InChI | InChI=1S/C6H3F2NO3/c7-3-1-5(9(11)12)6(10)2-4(3)8/h1-2,10H | | InChIKey | KZODZOGGCQZLNF-UHFFFAOYSA-N | | SMILES | C1(O)=CC(F)=C(F)C=C1[N+]([O-])=O |
| | 3,4-Difluoro-6-Nitrophenol Usage And Synthesis |
| | 3,4-Difluoro-6-Nitrophenol Preparation Products And Raw materials |
|