|
| (3,4,5-Trichlorophenyl)boronic acid Basic information |
Product Name: | (3,4,5-Trichlorophenyl)boronic acid | Synonyms: | (3,4,5-Trichlorophenyl)boronic acid;3,4,5-Trichlorophenylboronic acid;BORONIC ACID,B-(3,4,5-TRICHLOROPHENYL)-;3,4,5-Trichlorophenylboronic Acid (contains varying amounts of Anhydride);3,4,5-Trichlorophenylboronic acid, 98.9%;3,4,5-Trichlorobenzeneboronic Acid;(3,4,5-Trichlorophenyl)boronic acid ISO 9001:2015 REACH;3,4,5-Trichlorophenylboronic acid, (3,4,5-Trichlorophenyl)boronic acid | CAS: | 862248-93-9 | MF: | C6H4BCl3O2 | MW: | 225.26 | EINECS: | | Product Categories: | | Mol File: | 862248-93-9.mol |  |
| (3,4,5-Trichlorophenyl)boronic acid Chemical Properties |
Melting point | >300°C | Boiling point | 379.1±52.0 °C(Predicted) | density | 1.60±0.1 g/cm3(Predicted) | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | solubility | DMSO (Slightly), Methanol (Slightly) | pka | 6.37±0.11(Predicted) | form | Solid | color | White to Off-White | InChI | InChI=1S/C6H4BCl3O2/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,11-12H | InChIKey | KTEXVCMJBYWOSG-UHFFFAOYSA-N | SMILES | B(C1=CC(Cl)=C(Cl)C(Cl)=C1)(O)O |
| (3,4,5-Trichlorophenyl)boronic acid Usage And Synthesis |
| (3,4,5-Trichlorophenyl)boronic acid Preparation Products And Raw materials |
|