|
|
| | cis-DL-3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid Basic information |
| | cis-DL-3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid Chemical Properties |
| Melting point | 95-96℃ | | Boiling point | 291℃ | | density | 1.433 | | Fp | 130℃ | | solubility | Chloroform (Slightly), Dichloromethane (Sparingly), Methanol (Slightly) | | form | Solid | | pka | 4.66±0.42(Predicted) | | color | White to Off-White | | Stability: | Light Sensitive | | InChI | InChI=1/C8H10Cl2O2/c1-8(2)4(3-5(9)10)6(8)7(11)12/h3-4,6H,1-2H3,(H,11,12)/t4-,6-/s3 | | InChIKey | LLMLSUSAKZVFOA-BNFWCSRPNA-N | | SMILES | [C@@H]1(C(O)=O)[C@H](/C=C(/Cl)\Cl)C1(C)C |&1:0,4,r| | | EPA Substance Registry System | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (1R,3R)-rel- (59042-49-8) |
| | cis-DL-3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid Usage And Synthesis |
| Chemical Properties | It is white solid, m.p. 88～89℃, insoluble in water, soluble in benzene, toluene, carbon tetrachloride, chloroform and other solvents. | | Uses | rac-cis-Permethrinic acid is a potent insecticide used in the agricultural industry to eliminate unwanted pests from crops. rac-cis-Permethrinic acid is also metabolite of pyrethroid compounds, a group of pesticides that are relatively low toxicity (to organisms that are not intended to be targeted) and biodegradable. |
| | cis-DL-3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid Preparation Products And Raw materials |
|