|
|
| | 6-Chloropyridine-2-boronic acid Basic information |
| Product Name: | 6-Chloropyridine-2-boronic acid | | Synonyms: | (6-Chloro-2-pyridinyl)boronic acid;B-(6-Chloro-2-pyridinyl)boronic acid;2-Borono-6-chloropyridine;6-Chloro-2-pyridineboronic acid;(6-CHLORO-2-PYRIDINYL)BORONIC ACID; B-(6-CHLORO-2-PYRIDINYL)BORONIC ACID;2-chloro-6-(dihydroxy-l3-bromanyl)pyridine;(6-Chloro-2-pyridyl)boronic acid;6-chloropyridin-2-yl-2-boronic | | CAS: | 652148-90-8 | | MF: | C5H5BClNO2 | | MW: | 157.36 | | EINECS: | | | Product Categories: | | | Mol File: | 652148-90-8.mol |  |
| | 6-Chloropyridine-2-boronic acid Chemical Properties |
| Boiling point | 355℃ | | density | 1.41 | | Fp | 169℃ | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 6.82±0.53(Predicted) | | form | solid | | color | Yellow |
| | 6-Chloropyridine-2-boronic acid Usage And Synthesis |
| | 6-Chloropyridine-2-boronic acid Preparation Products And Raw materials |
|