|
|
| | (R)-1-(3-Fluorophenyl)ethylamine Basic information |
| Product Name: | (R)-1-(3-Fluorophenyl)ethylamine | | Synonyms: | (R)-1-(3-FLUOROPHENYL)ETHANAMINE-HCL;(1R)-1-(3-fluorophenyl)ethan-1-aMine;(R)-3-Fluoro-alpha-methylbenzylamine;Benzenemethanamine, 3-fluoro-α-methyl-, (αR)-;(R)-1-(3-Fluorophenyl)ethylamine;(1R)-1-(3-Fluorophenyl)ethylamine;(aR)-3-Fluoro-a-methyl-benzenemethanamine;Benzenemethanamine,3-fluoro-a-methyl-, (aR)- | | CAS: | 761390-58-3 | | MF: | C8H10FN | | MW: | 139.17 | | EINECS: | | | Product Categories: | | | Mol File: | 761390-58-3.mol |  |
| | (R)-1-(3-Fluorophenyl)ethylamine Chemical Properties |
| Boiling point | 182.6±15.0 °C(Predicted) | | density | 1.063±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 8.72±0.10(Predicted) | | form | liquid | | color | Light yellow | | InChI | InChI=1/C8H10FN/c1-6(10)7-3-2-4-8(9)5-7/h2-6H,10H2,1H3/t6-/s3 | | InChIKey | ASNVMKIDRJZXQZ-ISZMHOAENA-N | | SMILES | [C@@H](C1C=CC=C(F)C=1)(N)C |&1:0,r| |
| | (R)-1-(3-Fluorophenyl)ethylamine Usage And Synthesis |
| | (R)-1-(3-Fluorophenyl)ethylamine Preparation Products And Raw materials |
|