- 4,4'-Divinylbiphenyl
-
- $2.00 / 1KG
-
2019-07-06
- CAS:4433-13-0
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1 ton
|
| | 4,4'-Divinylbiphenyl Basic information |
| Product Name: | 4,4'-Divinylbiphenyl | | Synonyms: | 4,4'-Divinylbiphenyl;4,4'-Diethenyl-1,1'-biphenyl;4,4-Divinyl-p-biphenyl;1,1'-Biphenyl,4,4'-diethenyl-;4,4'-Divinyl-1,1'-biphenyl;1-ethenyl-4-(4-ethenylphenyl)benzene;4,4'-diethenylbiphenyl;4,4'-Divinyl-1,1'-biphenyl,95%(stabilized with TBC) | | CAS: | 4433-13-0 | | MF: | C16H14 | | MW: | 206.28 | | EINECS: | | | Product Categories: | | | Mol File: | 4433-13-0.mol |  |
| | 4,4'-Divinylbiphenyl Chemical Properties |
| Melting point | 153 °C(Solv: water (7732-18-5); ethanol (64-17-5)) | | Boiling point | 341.6±22.0 °C(Predicted) | | density | 0.998±0.06 g/cm3(Predicted) | | storage temp. | -20°C, stored under nitrogen | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C16H14/c1-3-13-5-9-15(10-6-13)16-11-7-14(4-2)8-12-16/h3-12H,1-2H2 | | InChIKey | IYSVFZBXZVPIFA-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(C=C)C=C2)=CC=C(C=C)C=C1 |
| | 4,4'-Divinylbiphenyl Usage And Synthesis |
| Preparation | The preparation of 4,4'-Divinylbiphenyl is as follows: Reaction flask (10 mL) equipped with stirring bar was charged with 4-vinylphenylboronic acid (135mg, 0.91 mmol), ethanol (96%) (2 mL), [{Pd(μ-OH)Cl(IPr)}2] (510-4 g, 4.55 × 10-7 mol). Reactionmixture was stirred at 22 C for 6 h. After completion of the reaction solvent was evaporated, theresidue was dissolved in hexane (5 mL) and extracted with water (2 × 2 mL). The organic layer wasdried over magnesium sulphate, and hexane was evaporated under reduced pressure. 176 mg of 4,4'-divinylbiphenyl was obtained as a white solid. Yield = 93%. 
|
| | 4,4'-Divinylbiphenyl Preparation Products And Raw materials |
| Raw materials | 1,1'-Biphenyl, 4-ethenyl-4'-methyl--->Benzenesulfonic acid, 4-methyl-, ethenyl ester-->[1,1'-Biphenyl]-4,4'-dimethanol, α4,α4'-dimethyl---> Triethylene glycol dimethyl ether-->4-VINYLPHENYLBORONIC ACID-->4,4'-Diacetylbiphenyl-->4,4'-BIPHENYLDIBORONIC ACID BIS(NEOPENTYL GLYCOL) ESTER-->4,4'-DIETHYNYLBIPHENYL-->4,4'-BIPHENYLDICARBONYL CHLORIDE-->4,4'-Dimethylbiphenyl-->4-Bromostyrene-->4,4'-Dibromobiphenyl-->Dichloromethane-->4-Bromophenol |
|