|
|
| | 2-Chloro-5-methoxypyrimidine Basic information |
| | 2-Chloro-5-methoxypyrimidine Chemical Properties |
| Melting point | 73-78℃ | | Boiling point | 268.8±13.0 °C(Predicted) | | density | 1.292±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | -1.26±0.22(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C5H5ClN2O/c1-9-4-2-7-5(6)8-3-4/h2-3H,1H3 | | InChIKey | RSUBGBZOMBTDTI-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(OC)C=N1 | | CAS DataBase Reference | 22536-65-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 37/38-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HS Code | 29335990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 2-Chloro-5-methoxypyrimidine Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses | 2-Chloro-5-methoxypyrimidine is used in the regioselective synthesis of aminoimidazopyrimidines with triflic anhydride and pyridine bases | | Synthesis | General procedure for the synthesis of 2-chloro-5-methoxypyrimidine from 2,4-dichloro-5-methoxypyrimidine:
1. 2,4-Dichloro-5-methoxypyrimidine (43 g, 0.24 mol), zinc powder (86 g, 1.32 mol), ethanol (200 mL), and water (200 mL) were mixed, heated to reflux, and the reaction was maintained for 4 hours.
2. After completion of the reaction, the reaction mixture was filtered while hot.
3. The filtrate was distilled under reduced pressure to remove ethanol. 4.
4. After cooling, the product was extracted with ether. 5.
5. The extract was recrystallized from light petroleum ether (boiling point: 40-60 °C) to give purified 2-chloro-5-methoxypyrimidine (20 g, 58% yield). | | References | [1] Patent: WO2011/144577, 2011, A1. Location in patent: Page/Page column 24 [2] Patent: WO2011/144578, 2011, A1. Location in patent: Page/Page column 27 |
| | 2-Chloro-5-methoxypyrimidine Preparation Products And Raw materials |
|