- L-(+)-Erythrulose
-
- $0.00 / 10G
-
2026-05-23
- CAS:533-50-6
- Min. Order: 10G
- Purity: 98%min
- Supply Ability: 30kg/month
- L-Erythrulose
-
- $32.00 / 1mg
-
2026-04-20
- CAS:533-50-6
- Min. Order:
- Purity: 99.97%
- Supply Ability: 10g
- L-(+)-Erythrulose
-
- $35.00 / 1kg
-
2025-09-25
- CAS:533-50-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | L-(+)-Erythrulose Basic information |
| Product Name: | L-(+)-Erythrulose | | Synonyms: | L-(+)-Erythrulose;(3S)-1,3,4-trihydroxybutan-2-one;L-(+)-erythrulose hydrate;(3S)-1,3,4-Trihydroxy-2-butanone;(S)-1,3,4-Trihydroxy-2-butanone;L-glycero-2-Tetrulose;C02045;L-Glycero-tetrulose | | CAS: | 533-50-6 | | MF: | C4H8O4 | | MW: | 120.1 | | EINECS: | | | Product Categories: | | | Mol File: | 533-50-6.mol |  |
| | L-(+)-Erythrulose Chemical Properties |
| alpha | D18 +11.4° (c = 2.4 in water) | | Boiling point | 144.07°C (rough estimate) | | density | 1.420 | | refractive index | 1.4502 (estimate) | | Fp | 110℃ | | storage temp. | room temp | | solubility | Methanol (Slightly), Water (Slightly) | | pka | 12.00±0.20(Predicted) | | form | Oil | | color | Colourless | | Optical Rotation | [α]/D 12.0±2.0°, c = 2 in H2O (24 h) | | Stability: | Hygroscopic | | InChI | InChI=1S/C4H8O4/c5-1-3(7)4(8)2-6/h3,5-7H,1-2H2/t3-/m0/s1 | | InChIKey | UQPHVQVXLPRNCX-VKHMYHEASA-N | | SMILES | C(O)C(=O)[C@@H](O)CO |
| WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 10 - Combustible liquids |
| | L-(+)-Erythrulose Usage And Synthesis |
| Chemical Properties | Clear light yellow liquid | | Uses | L-Erythrulose is the L-isomer of D-Erythrulose (E650145), a tetrose carbohydrate that is used in various self-tanning cosmetics combined with dihydroxyacetone. | | Uses | L-(+)-Erythrulose is used as a tanning agent in the cosmetics industry and a source of chiral ethyl ketones used in aldo reaction organic synthesis. | | Definition | ChEBI: L-erythrulose is an erythrulose. It has a role as a human metabolite. It is an enantiomer of a D-erythrulose. |
| | L-(+)-Erythrulose Preparation Products And Raw materials |
|