| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:3-Hydroxy-4-Methoxy-Mandelic Acid Ethyl Ester CAS:91971-78-7 Package:1g,5g
|
| Company Name: |
Chemsky(shanghai)International Co.,Ltd.
|
| Tel: |
021-50135380 |
| Email: |
shchemsky@sina.com |
| Products Intro: |
Product Name:3-Hydroxy-4-Methoxy-Mandelic Acid Ethyl Ester CAS:91971-78-7 Purity:98%
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Ethyl 3-hydroxy-4-methoxy-mandelate CAS:91971-78-7 Purity:>=99.0% Package:1G Remarks:78814-1G
|
|
| | Ethyl 3-hydroxy-4-methoxy-mandelate Basic information |
| | Ethyl 3-hydroxy-4-methoxy-mandelate Chemical Properties |
| Melting point | 124-130 °C | | Boiling point | 391.9±42.0 °C(Predicted) | | density | 1.260±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform, Ethyl Acetate, Methanol | | form | Solid | | pka | 9.58±0.10(Predicted) | | color | Off-White | | BRN | 3137338 | | InChI | 1S/C11H14O5/c1-3-16-11(14)10(13)7-4-5-9(15-2)8(12)6-7/h4-6,10,12-13H,3H2,1-2H3 | | InChIKey | TVPGKWGQPSIRLU-UHFFFAOYSA-N | | SMILES | CCOC(=O)C(O)c1ccc(OC)c(O)c1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Ethyl 3-hydroxy-4-methoxy-mandelate Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Amebicide. |
| | Ethyl 3-hydroxy-4-methoxy-mandelate Preparation Products And Raw materials |
|