|
|
| | β-D-Glucopyranosiduronic acid, (2S)-3,4-dihydro-5,6-dihydroxy-4-oxo-2-phenyl-2H-1-benzopyran-7-yl Basic information |
| | β-D-Glucopyranosiduronic acid, (2S)-3,4-dihydro-5,6-dihydroxy-4-oxo-2-phenyl-2H-1-benzopyran-7-yl Chemical Properties |
| Melting point | 230 °C | | Boiling point | 847.4±65.0 °C(Predicted) | | density | 1.688±0.06 g/cm3(Predicted) | | pka | 2.73±0.70(Predicted) | | InChIKey | UVNUGBQJLDGZKE-IJXNHZEVNA-N | | SMILES | OC1C(=C(O[C@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](C(=O)O)O2)O)C=C2O[C@H](C3C=CC=CC=3)CC(=O)C=12)O |&1:5,6,7,9,11,20,r| |
| | β-D-Glucopyranosiduronic acid, (2S)-3,4-dihydro-5,6-dihydroxy-4-oxo-2-phenyl-2H-1-benzopyran-7-yl Usage And Synthesis |
| Uses | Dihydrobaicalin is a flavonoid glycoside, which can be isolated from American skullcap (Scutellaria lateriflora L.)[1]. | | References | [1] Bergeron C, et al. Comparison of the chemical composition of extracts from Scutellaria lateriflora using accelerated solvent extraction and supercritical fluid extraction versus standard hot water or 70% ethanol extraction[J]. Journal of agricultural and food chemistry, 2005, 53(8): 3076-3080. |
| | β-D-Glucopyranosiduronic acid, (2S)-3,4-dihydro-5,6-dihydroxy-4-oxo-2-phenyl-2H-1-benzopyran-7-yl Preparation Products And Raw materials |
|