5-Chlorobiphenyl-2-boronic Acid manufacturers
|
| | 5-Chlorobiphenyl-2-boronic Acid Basic information |
| Product Name: | 5-Chlorobiphenyl-2-boronic Acid | | Synonyms: | Boronic acid, B-(5-chloro[1,1'-biphenyl]-2-yl)-;5-Chlorobiphenyl-2-boronic Acid;B-(5-Chloro[1,1′-biphenyl]-2-yl)boronic acid;5-chlorobiphenyl 2-boric acid;(5-chloro-[1,1'-biphenyl]-2-yl)boronic acid;B-(5-chloro[1,1'-biphenyl]-2-yl)-Boronic acid | | CAS: | 2226739-30-4 | | MF: | C12H10BClO2 | | MW: | 232.47 | | EINECS: | | | Product Categories: | | | Mol File: | 2226739-30-4.mol |  |
| | 5-Chlorobiphenyl-2-boronic Acid Chemical Properties |
| Boiling point | 424.9±55.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | pka | 8.36±0.58(Predicted) | | InChI | InChI=1S/C12H10BClO2/c14-10-6-7-12(13(15)16)11(8-10)9-4-2-1-3-5-9/h1-8,15-16H | | InChIKey | USYCVMIVHUOLLP-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(Cl)C=C1C1=CC=CC=C1)(O)O |
| | 5-Chlorobiphenyl-2-boronic Acid Usage And Synthesis |
| Uses | 5-Chlorobiphenyl-2-boronic Acid belongs to the boronic acid series of compounds and is also a luminescent material that can be used in organic electroluminescent materials and devices. |
| | 5-Chlorobiphenyl-2-boronic Acid Preparation Products And Raw materials |
|