| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Methyl-5-bromoimidazole Basic information |
| | 4-Methyl-5-bromoimidazole Chemical Properties |
| Melting point | 140-143 | | Boiling point | 328.5±22.0 °C(Predicted) | | density | 1.723±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 12.13±0.10(Predicted) | | form | solid | | color | White | | InChI | InChI=1S/C4H5BrN2/c1-3-4(5)7-2-6-3/h2H,1H3,(H,6,7) | | InChIKey | APWKDMLCPWYWKA-UHFFFAOYSA-N | | SMILES | C1NC(Br)=C(C)N=1 |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | Hazard Note | Irritant/Keep Cold | | HS Code | 2933299090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 4-Methyl-5-bromoimidazole Usage And Synthesis |
| | 4-Methyl-5-bromoimidazole Preparation Products And Raw materials |
|