|
|
| | 6-Aminomethyl-5,6-dihydromorphanthridine Basic information |
| Product Name: | 6-Aminomethyl-5,6-dihydromorphanthridine | | Synonyms: | 6-(AMINOMETHYL)-6,11-DIHYDRO-DIBENZOAZEPINE;6,11-Dihydro-5H-dibenz[b,e]azepine-6-methanamine;6-Aminomethyl-5,6-dihydromorphanthridine;6-Aminomethyl-6,11-dihydro-5H-dibenz [b,e]azepine hydrogen fumarate;Epinastine Related CoMpound A;Epinastine Impurity 9;Epinastine USP Related Compound A;Epistine related compound A | | CAS: | 41218-84-2 | | MF: | C15H16N2 | | MW: | 224.3 | | EINECS: | | | Product Categories: | | | Mol File: | 41218-84-2.mol |  |
| | 6-Aminomethyl-5,6-dihydromorphanthridine Chemical Properties |
| Boiling point | 401.9±24.0 °C(Predicted) | | density | 1.096 | | pka | 9.42±0.29(Predicted) | | InChI | InChI=1S/C15H16N2/c16-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)17-15/h1-8,15,17H,9-10,16H2 | | InChIKey | FPKDBVUHIXYLNP-UHFFFAOYSA-N | | SMILES | N1C(CN)C2=CC=CC=C2CC2=CC=CC=C12 | | CAS DataBase Reference | 41218-84-2(CAS DataBase Reference) |
| | 6-Aminomethyl-5,6-dihydromorphanthridine Usage And Synthesis |
| Uses | (6,11-Dihydro-5H-dibenzo[b,e]azepin-6-yl)methanamine is an impurity of Epinastine (E588560), a tetracyclic, non-sedating histamine H1 receptor antagonist. Antihistaminic. |
| | 6-Aminomethyl-5,6-dihydromorphanthridine Preparation Products And Raw materials |
|