DL-BENZYLSUCCINIC ACID manufacturers
|
| | DL-BENZYLSUCCINIC ACID Basic information |
| | DL-BENZYLSUCCINIC ACID Chemical Properties |
| Melting point | 161-163°C | | Boiling point | 331.4±22.0 °C(Predicted) | | density | 1.290±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) | | form | Solid | | pka | 3.97±0.10(Predicted) | | color | White to Off-White | | BRN | 1966188 | | InChI | InChI=1S/C11H12O4/c12-10(13)7-9(11(14)15)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,13)(H,14,15) | | InChIKey | GTOFKXZQQDSVFH-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(CC1=CC=CC=C1)CC(O)=O | | CAS DataBase Reference | 884-33-3(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2917399590 | | Storage Class | 11 - Combustible Solids |
| | DL-BENZYLSUCCINIC ACID Usage And Synthesis |
| Uses | An effective inhibitor of carboxypeptidase A. | | Definition | ChEBI: A dicarboxylic acid consisting of succinic acid carrying a 2-benzyl substituent. |
| | DL-BENZYLSUCCINIC ACID Preparation Products And Raw materials |
|