- Sophocarpine
-
- $45.00 / 5mg
-
2026-01-16
- CAS:6483-15-4
- Min. Order:
- Purity: 99.89%
- Supply Ability: 10g
- Sophocarpine
-
- $0.00 / 20mg
-
2023-02-24
- CAS:6483-15-4
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
- Sophocarpine
-
- $15.00 / 1KG
-
2021-07-02
- CAS:6483-15-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | Sophocarpine Basic information |
| Product Name: | Sophocarpine | | Synonyms: | Sophocarpine;SOPHOCARPINE(RG);13,14-DidehydroMatridin-15-one, 9CI;Sophocarpine, 98%, from Sophora flavescens Aiton;Matridin-15-one, 13,14-didehydro-, monohydrate;13,14-Didehydromatridin-15-one;1H,5H,10H-Dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridin-10-one, 2,3,6,7,7a,8,13,13a,13b,13c-decahydro-, (7aS,13aR,13bR,13cS)-;(41S,7aS,13aR,13bR)-2,3,41,6,7,7a,8,13,13a,13b-Decahydro-1H,5H,10H-dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridin-10-one | | CAS: | 6483-15-4 | | MF: | C15H22N2O | | MW: | 246.35 | | EINECS: | | | Product Categories: | Inhibitors;Alkaloids | | Mol File: | 6483-15-4.mol |  |
| | Sophocarpine Chemical Properties |
| Melting point | 54～55℃ | | Boiling point | 170-210 °C(Press: 5 Torr) | | density | 1.19±0.1 g/cm3(Predicted) | | solubility | DMSO: 2 mg/ml; Ethanol: 1 mg/ml * | | form | A crystalline solid | | pka | 9.59±0.20(Predicted) | | color | White to off-white | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | InChI=1S/C15H22N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h1,7,11-13,15H,2-6,8-10H2/t11-,12+,13+,15?/m0/s1 | | InChIKey | AAGFPTSOPGCENQ-IRYOAWFSSA-N | | SMILES | N12CCC[C@]3([H])C1[C@@]([H])([C@@]1([H])CC=CC(=O)N1C3)CCC2 |
| | Sophocarpine Usage And Synthesis |
| Uses | Sophocarpine is an intermediate in the synthesis of (+)-Matrine-d3 (M197872). (+)-Matrine-d3, is a labeled analogue of (+)-Matrine, an alkaloid compound extracted from the roots of Sophora species which maintain anti-inflammatory, anti-cancer and a host of other positive pharmacological effects. Apoptotic agent. | | IC 50 | PI3K |
| | Sophocarpine Preparation Products And Raw materials |
|