|
|
| | 2,4,6-Tri-(6-aminocaproic acid)-1,3,5-triazine Basic information |
| Product Name: | 2,4,6-Tri-(6-aminocaproic acid)-1,3,5-triazine | | Synonyms: | 6,6',6"-(1,3,5-triazine-2,4,6-triyltriimino)trishexanoic;2,4,6-Tris(5-carboxypentylamino)-1,3,5-triazine;6,6',6''-((1,3,5-Triazine-2,4,6-triyl)-tris(azanediyl))trihexanoic acid;Corrosion inhibitor ABC 730;belcor 590;Hexanoic acid, 6,6,6-(1,3,5-triazine-2,4,6-triyltriimino)tris-;6,6′,6′′-(1,3,5-Triazin-2,4,6-triyltriimino)trihexansure;6,6',6''-(1,3,5-triazine-2,4,6-triyltriimino)tris-Hexanoic acid | | CAS: | 80584-91-4 | | MF: | C21H36N6O6 | | MW: | 468.55 | | EINECS: | 279-505-5 | | Product Categories: | | | Mol File: | 80584-91-4.mol |  |
| | 2,4,6-Tri-(6-aminocaproic acid)-1,3,5-triazine Chemical Properties |
| Melting point | 186-188 °C(Solv: acetic acid (64-19-7)) | | Boiling point | 773.8±70.0 °C(Predicted) | | density | 1.305 | | vapor pressure | 0Pa at 20℃ | | pka | 4.43±0.10(Predicted) | | Water Solubility | 1.3mg/L at 25℃ | | InChIKey | BKKWPPMEXIXECW-UHFFFAOYSA-N | | SMILES | N1=C(NCCCCCC(O)=O)N=C(NCCCCCC(O)=O)N=C1NCCCCCC(O)=O | | LogP | 0.94 at 20℃ | | EPA Substance Registry System | Hexanoic acid, 6,6',6''-(1,3,5-triazine-2,4,6-triyltriimino)tris- (80584-91-4) |
| | 2,4,6-Tri-(6-aminocaproic acid)-1,3,5-triazine Usage And Synthesis |
| Uses | 1,3,5-Triazine-2,4,6-triaminocaproic acid, is of interest in fields such as agrochemicals, pharmaceuticals, and polymer chemistry due to its ability to form hydrogen bonds and participate in various chemical reactions. Its unique structure allows for potential applications in drug delivery systems and as a ligand in coordination chemistry. | | Flammability and Explosibility | Not classified |
| | 2,4,6-Tri-(6-aminocaproic acid)-1,3,5-triazine Preparation Products And Raw materials |
|