| Company Name: |
Nanjing Chemlin Chemical Co., Ltd
|
| Tel: |
025-83697070 13913916777 |
| Email: |
info@chemlin.com.cn |
| Products Intro: |
Product Name:1-(2,2-Difluoro-ethyl)piperazine
CAS:767609-14-3
Purity:0.98 Package:5KG; 1KG
|
| Company Name: |
Shanghai AQBioPharma Co., Ltd.
|
| Tel: |
13661411401 |
| Email: |
yinglv.que@aqbiopharma.com.cn |
| Products Intro: |
Product Name:1-(2,2-difluoroethyl)piperazine
CAS:767609-14-3
Purity:>98% Package:1kg;10kg;25kg
|
| Company Name: |
Jiangsu Aikon Biopharmaceutical R&D co.,Ltd.
|
| Tel: |
025-66028182 17714375163 |
| Email: |
yftan@aikonchem.com |
| Products Intro: |
Product Name:1-(2,2-Difluoroethyl)piperazine
CAS:767609-14-3
Purity:95+% Package:1g;5g;10g
|
|
| | Piperazine, 1-(2,2-difluoroethyl)- (9CI) Basic information |
| | Piperazine, 1-(2,2-difluoroethyl)- (9CI) Chemical Properties |
| Boiling point | 173.6±40.0 °C(Predicted) | | density | 1.054±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | form | liquid | | pka | 8.94±0.10(Predicted) | | color | Colourless to light yellow | | InChI | InChI=1S/C6H12F2N2/c7-6(8)5-10-3-1-9-2-4-10/h6,9H,1-5H2 | | InChIKey | JIARBLBYLGYCBZ-UHFFFAOYSA-N | | SMILES | N1(CC(F)F)CCNCC1 |
| | Piperazine, 1-(2,2-difluoroethyl)- (9CI) Usage And Synthesis |
| | Piperazine, 1-(2,2-difluoroethyl)- (9CI) Preparation Products And Raw materials |
|