|
|
| | 4-(4-Bromophenyl)-4-piperidinol Basic information |
| | 4-(4-Bromophenyl)-4-piperidinol Chemical Properties |
| Melting point | 167-170 °C (lit.) | | Boiling point | 361.0±42.0 °C(Predicted) | | density | 1.4066 (rough estimate) | | refractive index | 1.6120 (estimate) | | storage temp. | Sealed in dry,2-8°C | | form | powder to crystal | | pka | 13.92±0.20(Predicted) | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C11H14BrNO/c12-10-3-1-9(2-4-10)11(14)5-7-13-8-6-11/h1-4,13-14H,5-8H2 | | InChIKey | QNLXJYQUWCNYBH-UHFFFAOYSA-N | | SMILES | N1CCC(C2=CC=C(Br)C=C2)(O)CC1 | | CAS DataBase Reference | 57988-58-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29333999 | | Storage Class | 11 - Combustible Solids |
| | 4-(4-Bromophenyl)-4-piperidinol Usage And Synthesis |
| Chemical Properties | WHITE TO LIGHT YELLOW CRYSTALLINE POWDER | | Uses | 4-(4''-Bromophenyl)-4-hydroxypiperidine is a metabolite of bromoperidol. | | General Description | 4-(4-Bromophenyl)-4-piperidinol is reported to show potential antioxidant activity. Analgesic effects of 4-(4-bromophenyl)-4-piperidinol in mice has been studied using a tail immersion assay. |
| | 4-(4-Bromophenyl)-4-piperidinol Preparation Products And Raw materials |
|