|
|
| | 6-Amino-6-oxo-hexanoic acid Basic information |
| Product Name: | 6-Amino-6-oxo-hexanoic acid | | Synonyms: | 5-carbamoylpentanoic acid;adipic acid monoamide;6-Oxo-6-aminohexanoic acid;Adipamidic acid;ADIPAMIC ACID;Hexanoic acid, 6-amino-6-oxo-;6-Amino-6-oxo-hexanoic acid | | CAS: | 334-25-8 | | MF: | C6H11NO3 | | MW: | 145.16 | | EINECS: | | | Product Categories: | | | Mol File: | 334-25-8.mol |  |
| | 6-Amino-6-oxo-hexanoic acid Chemical Properties |
| Melting point | 293°C | | Boiling point | 264.26°C (rough estimate) | | density | 1.2511 (rough estimate) | | refractive index | 1.4300 (estimate) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.63(at 25℃) | | color | White to Off-White | | InChI | InChI=1S/C6H11NO3/c7-5(8)3-1-2-4-6(9)10/h1-4H2,(H2,7,8)(H,9,10) | | InChIKey | NOIZJQMZRULFFO-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCC(N)=O |
| | 6-Amino-6-oxo-hexanoic acid Usage And Synthesis |
| Definition | ChEBI: The monoamide of adipic acid. |
| | 6-Amino-6-oxo-hexanoic acid Preparation Products And Raw materials |
|