| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Tri-n-butylphosphonium tetrafluoroborate Basic information | | Reaction |
| | Tri-n-butylphosphonium tetrafluoroborate Chemical Properties |
| Melting point | 50-53 °C (lit.) | | Fp | >221 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | white | | InChI | InChI=1S/C12H27P.BF4/c1-4-7-10-13(11-8-5-2)12-9-6-3;2-1(3,4)5/h4-12H2,1-3H3;/q;-1/p+1 | | InChIKey | NCHAZLRRIGGCER-UHFFFAOYSA-O | | SMILES | [B-](F)(F)(F)F.[PH+](CCCC)(CCCC)CCCC |
| Risk Statements | 36/37/38 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2931599090 | | Storage Class | 13 - Non Combustible Solids |
| | Tri-n-butylphosphonium tetrafluoroborate Usage And Synthesis |
| Reaction |
- Air-stable, non-pyrophoric precursor of the Tri-n-butylphosphine ligand which is used in a variety of catalytic processes.
- Catalyst in Baylis-Hillman reactions.
- Azide reductions.
- Acylation of alcohols by anhydrides.
- Ligand for formate reduction of allyl carbonates.
- Synthesis of aromatic nitriles via Pd C-H functionalization.

| | General Description | May contain approximately 5% of other butyl isomers. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling |
| | Tri-n-butylphosphonium tetrafluoroborate Preparation Products And Raw materials |
|