|
|
| | 4-AMINO-2,6-DIBROMOPHENOL Basic information |
| | 4-AMINO-2,6-DIBROMOPHENOL Chemical Properties |
| Melting point | 195-196 °C(lit.) | | Boiling point | 295.6±40.0 °C(Predicted) | | density | 2.0444 (rough estimate) | | refractive index | 1.6400 (estimate) | | storage temp. | 2-8°C(protect from light) | | pka | 7.17±0.23(Predicted) | | Appearance | Light brown to brown Solid | | BRN | 2803732 | | InChI | InChI=1S/C6H5Br2NO/c7-4-1-3(9)2-5(8)6(4)10/h1-2,10H,9H2 | | InChIKey | HFYPXERYZGFDBD-UHFFFAOYSA-N | | SMILES | C1(O)=C(Br)C=C(N)C=C1Br | | CAS DataBase Reference | 609-21-2(CAS DataBase Reference) | | EPA Substance Registry System | Phenol, 4-amino-2,6-dibromo- (609-21-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29222900 |
| | 4-AMINO-2,6-DIBROMOPHENOL Usage And Synthesis |
| Chemical Properties | beige to pale brown crystalline powder | | Synthesis | The synthesis of 4-amino-2,6-dibromophenol is as follows:4-Nitro-2,6-dibromophenol (2.97g, 10mmol) was dissolved in ethanol (15ml) and water (3ml), and acetic acid (1ml) was added. Then heat and stir to raise the temperature to 80°C, and add iron powder (1.68g, 30mmol) in batches. After the addition is complete, the reaction solution is kept warm for 30 minutes, heating is stopped, filtered while hot, the filtrate is concentrated under reduced pressure, then ethyl acetate and water are added to the concentrated residue to extract, the organic phases are combined and dried, filtered, and the solvent is removed under reduced pressure. The residue was finally separated by column chromatography (ethyl acetate/petroleum ether=1/3) to obtain 4-amino-2,6-dibromophenol (2.52g, 94.4% yield).
|
| | 4-AMINO-2,6-DIBROMOPHENOL Preparation Products And Raw materials |
|